C17H28ClNO2 — CID 2988766
1-(2-phenylpropoxy)-3-piperidin-1-ylpropan-2-ol;hydrochloride (PubChem CID 2988766) has the molecular formula C17H28ClNO2 and a molecular weight of 313.87 g/mol. Its IUPAC name is 1-(2-phenylpropoxy)-3-piperidin-1-ylpropan-2-ol;hydrochloride.
| Compound Name | 1-(2-phenylpropoxy)-3-piperidin-1-ylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 2988766 |
| Molecular Formula | C17H28ClNO2 |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-(2-phenylpropoxy)-3-piperidin-1-ylpropan-2-ol;hydrochloride |
| SMILES | CC(COCC(O)CN1CCCCC1)c1ccccc1.Cl |
| InChI | InChI=1S/C17H27NO2.ClH/c1-15(16-8-4-2-5-9-16)13-20-14-17(19)12-18-10-6-3-7-11-18;/h2,4-5,8-9,15,17,19H,3,6-7,10-14H2,1H3;1H |
| InChIKey | FOUUYSLPOYPPPG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |