C24H29F3N4O3 — CID 42857933
N-[6-[4-(2-hydroxy-3-prop-2-enoxypropyl)-1,4-diazepan-1-yl]-3-pyridinyl]-2-(trifluoromethyl)benzamide (PubChem CID 42857933) has the molecular formula C24H29F3N4O3 and a molecular weight of 478.52 g/mol. Its IUPAC name is N-[6-[4-(2-hydroxy-3-prop-2-enoxypropyl)-1,4-diazepan-1-yl]-3-pyridinyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[6-[4-(2-hydroxy-3-prop-2-enoxypropyl)-1,4-diazepan-1-yl]-3-pyridinyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42857933 |
| Molecular Formula | C24H29F3N4O3 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[6-[4-(2-hydroxy-3-prop-2-enoxypropyl)-1,4-diazepan-1-yl]-3-pyridinyl]-2-(trifluoromethyl)benzamide |
| SMILES | C=CCOCC(O)CN1CCCN(c2ccc(NC(=O)c3ccccc3C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C24H29F3N4O3/c1-2-14-34-17-19(32)16-30-10-5-11-31(13-12-30)22-9-8-18(15-28-22)29-23(33)20-6-3-4-7-21(20)24(25,26)27/h2-4,6-9,15,19,32H,1,5,10-14,16-17H2,(H,29,33) |
| InChIKey | SPMMVCBSUYSKKP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|