C24H25ClF5N3O4 — CID 87959620
tert-butyl 2-[5-[(2-chloropyridine-3-carbonyl)amino]-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]-2-pyrrolidin-2-ylacetate (PubChem CID 87959620) has the molecular formula C24H25ClF5N3O4 and a molecular weight of 549.92 g/mol. Its IUPAC name is tert-butyl 2-[5-[(2-chloropyridine-3-carbonyl)amino]-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]-2-pyrrolidin-2-ylacetate.
| Compound Name | tert-butyl 2-[5-[(2-chloropyridine-3-carbonyl)amino]-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]-2-pyrrolidin-2-ylacetate |
|---|---|
| PubChem CID | 87959620 |
| Molecular Formula | C24H25ClF5N3O4 |
| Molecular Weight | 549.92 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | tert-butyl 2-[5-[(2-chloropyridine-3-carbonyl)amino]-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]-2-pyrrolidin-2-ylacetate |
| SMILES | CC(C)(C)OC(=O)C(Oc1cc(NC(=O)c2cccnc2Cl)ccc1C(F)(F)C(F)(F)F)C1CCCN1 |
| InChI | InChI=1S/C24H25ClF5N3O4/c1-22(2,3)37-21(35)18(16-7-5-10-31-16)36-17-12-13(8-9-15(17)23(26,27)24(28,29)30)33-20(34)14-6-4-11-32-19(14)25/h4,6,8-9,11-12,16,18,31H,5,7,10H2,1-3H3,(H,33,34) |
| InChIKey | QSTSOTIZXXYEAG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|