C19H18F6N4O — CID 87832771
2-fluoro-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-(piperazin-1-ylmethyl)phenyl]pyridine-3-carboxamide (PubChem CID 87832771) has the molecular formula C19H18F6N4O and a molecular weight of 432.37 g/mol. Its IUPAC name is 2-fluoro-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-(piperazin-1-ylmethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-(piperazin-1-ylmethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87832771 |
| Molecular Formula | C19H18F6N4O |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-fluoro-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-(piperazin-1-ylmethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)C(F)(F)F)c(CN2CCNCC2)c1)c1cccnc1F |
| InChI | InChI=1S/C19H18F6N4O/c20-16-14(2-1-5-27-16)17(30)28-13-3-4-15(18(21,22)19(23,24)25)12(10-13)11-29-8-6-26-7-9-29/h1-5,10,26H,6-9,11H2,(H,28,30) |
| InChIKey | AXACSTCTRSFZDM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|