C20H25FN4O2 — CID 69260763
N-[4-tert-butyl-3-[[2-(dimethylamino)acetyl]amino]phenyl]-2-fluoropyridine-3-carboxamide (PubChem CID 69260763) has the molecular formula C20H25FN4O2 and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[4-tert-butyl-3-[[2-(dimethylamino)acetyl]amino]phenyl]-2-fluoropyridine-3-carboxamide.
| Compound Name | N-[4-tert-butyl-3-[[2-(dimethylamino)acetyl]amino]phenyl]-2-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 69260763 |
| Molecular Formula | C20H25FN4O2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[4-tert-butyl-3-[[2-(dimethylamino)acetyl]amino]phenyl]-2-fluoropyridine-3-carboxamide |
| SMILES | CN(C)CC(=O)Nc1cc(NC(=O)c2cccnc2F)ccc1C(C)(C)C |
| InChI | InChI=1S/C20H25FN4O2/c1-20(2,3)15-9-8-13(11-16(15)24-17(26)12-25(4)5)23-19(27)14-7-6-10-22-18(14)21/h6-11H,12H2,1-5H3,(H,23,27)(H,24,26) |
| InChIKey | HKHWDHNIABFWCR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|