C22H21ClF5N3O4 — CID 158218178
2-[5-[(2-chloropyridine-3-carbonyl)amino]-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3-pyrrolidin-1-ylbutanoic acid (PubChem CID 158218178) has the molecular formula C22H21ClF5N3O4 and a molecular weight of 521.87 g/mol. Its IUPAC name is 2-[5-[(2-chloropyridine-3-carbonyl)amino]-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3-pyrrolidin-1-ylbutanoic acid.
| Compound Name | 2-[5-[(2-chloropyridine-3-carbonyl)amino]-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3-pyrrolidin-1-ylbutanoic acid |
|---|---|
| PubChem CID | 158218178 |
| Molecular Formula | C22H21ClF5N3O4 |
| Molecular Weight | 521.87 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 2-[5-[(2-chloropyridine-3-carbonyl)amino]-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3-pyrrolidin-1-ylbutanoic acid |
| SMILES | CC(C(Oc1cc(NC(=O)c2cccnc2Cl)ccc1C(F)(F)C(F)(F)F)C(=O)O)N1CCCC1 |
| InChI | InChI=1S/C22H21ClF5N3O4/c1-12(31-9-2-3-10-31)17(20(33)34)35-16-11-13(6-7-15(16)21(24,25)22(26,27)28)30-19(32)14-5-4-8-29-18(14)23/h4-8,11-12,17H,2-3,9-10H2,1H3,(H,30,32)(H,33,34) |
| InChIKey | GCXOHBKEQYQGPI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|