C27H28F5N5O2 — CID 87959100
N-[4-(1,1,2,2,2-pentafluoroethyl)-3-(1-piperidin-1-ylethoxy)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide (PubChem CID 87959100) has the molecular formula C27H28F5N5O2 and a molecular weight of 549.54 g/mol. Its IUPAC name is N-[4-(1,1,2,2,2-pentafluoroethyl)-3-(1-piperidin-1-ylethoxy)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-(1,1,2,2,2-pentafluoroethyl)-3-(1-piperidin-1-ylethoxy)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87959100 |
| Molecular Formula | C27H28F5N5O2 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | N-[4-(1,1,2,2,2-pentafluoroethyl)-3-(1-piperidin-1-ylethoxy)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
| SMILES | CC(Oc1cc(NC(=O)c2cccnc2NCc2ccncc2)ccc1C(F)(F)C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C27H28F5N5O2/c1-18(37-14-3-2-4-15-37)39-23-16-20(7-8-22(23)26(28,29)27(30,31)32)36-25(38)21-6-5-11-34-24(21)35-17-19-9-12-33-13-10-19/h5-13,16,18H,2-4,14-15,17H2,1H3,(H,34,35)(H,36,38) |
| InChIKey | DJRYCJYRSBUXIG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|