C22H22F3N5O4S — CID 10097808
N-[3-[2-(methanesulfonamido)ethoxy]-4-(trifluoromethyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide (PubChem CID 10097808) has the molecular formula C22H22F3N5O4S and a molecular weight of 509.51 g/mol. Its IUPAC name is N-[3-[2-(methanesulfonamido)ethoxy]-4-(trifluoromethyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | N-[3-[2-(methanesulfonamido)ethoxy]-4-(trifluoromethyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10097808 |
| Molecular Formula | C22H22F3N5O4S |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | N-[3-[2-(methanesulfonamido)ethoxy]-4-(trifluoromethyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)NCCOc1cc(NC(=O)c2cccnc2NCc2ccncc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C22H22F3N5O4S/c1-35(32,33)29-11-12-34-19-13-16(4-5-18(19)22(23,24)25)30-21(31)17-3-2-8-27-20(17)28-14-15-6-9-26-10-7-15/h2-10,13,29H,11-12,14H2,1H3,(H,27,28)(H,30,31) |
| InChIKey | APHDSTCFYMBKQV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|