C25H25F3N4O — CID 70992760
4-methyl-N-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]-3-pyridin-3-ylbenzamide (PubChem CID 70992760) has the molecular formula C25H25F3N4O and a molecular weight of 454.50 g/mol. Its IUPAC name is 4-methyl-N-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]-3-pyridin-3-ylbenzamide.
| Compound Name | 4-methyl-N-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]-3-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 70992760 |
| Molecular Formula | C25H25F3N4O |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 4-methyl-N-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]-3-pyridin-3-ylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCNCC3)c(C(F)(F)F)c2)cc1-c1cccnc1 |
| InChI | InChI=1S/C25H25F3N4O/c1-17-4-5-18(13-22(17)19-3-2-8-30-15-19)24(33)31-21-7-6-20(23(14-21)25(26,27)28)16-32-11-9-29-10-12-32/h2-8,13-15,29H,9-12,16H2,1H3,(H,31,33) |
| InChIKey | RWEPHLIKJAGMOW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |