C27H26F3N5O — CID 24871562
4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-(2-pyrimidin-5-ylethynyl)benzamide (PubChem CID 24871562) has the molecular formula C27H26F3N5O and a molecular weight of 493.53 g/mol. Its IUPAC name is 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-(2-pyrimidin-5-ylethynyl)benzamide.
| Compound Name | 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-(2-pyrimidin-5-ylethynyl)benzamide |
|---|---|
| PubChem CID | 24871562 |
| Molecular Formula | C27H26F3N5O |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-(2-pyrimidin-5-ylethynyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C#Cc1cncnc1 |
| InChI | InChI=1S/C27H26F3N5O/c1-19-3-5-22(13-21(19)6-4-20-15-31-18-32-16-20)26(36)33-24-8-7-23(25(14-24)27(28,29)30)17-35-11-9-34(2)10-12-35/h3,5,7-8,13-16,18H,9-12,17H2,1-2H3,(H,33,36) |
| InChIKey | ZXMWELALLBODEX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|