C28H27F3N4O — CID 130396044
4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-(2-pyridin-4-ylethynyl)benzamide (PubChem CID 130396044) has the molecular formula C28H27F3N4O and a molecular weight of 492.55 g/mol. Its IUPAC name is 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-(2-pyridin-4-ylethynyl)benzamide.
| Compound Name | 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-(2-pyridin-4-ylethynyl)benzamide |
|---|---|
| PubChem CID | 130396044 |
| Molecular Formula | C28H27F3N4O |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-(2-pyridin-4-ylethynyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C#Cc1ccncc1 |
| InChI | InChI=1S/C28H27F3N4O/c1-20-3-5-23(17-22(20)6-4-21-9-11-32-12-10-21)27(36)33-25-8-7-24(26(18-25)28(29,30)31)19-35-15-13-34(2)14-16-35/h3,5,7-12,17-18H,13-16,19H2,1-2H3,(H,33,36) |
| InChIKey | MIDPZUGQLYRHED-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|