C18H20FN3O — CID 69263023
N-(5,5-dimethyl-1,2,3,4-tetrahydro-1-benzazepin-8-yl)-2-fluoropyridine-3-carboxamide (PubChem CID 69263023) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(5,5-dimethyl-1,2,3,4-tetrahydro-1-benzazepin-8-yl)-2-fluoropyridine-3-carboxamide.
| Compound Name | N-(5,5-dimethyl-1,2,3,4-tetrahydro-1-benzazepin-8-yl)-2-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 69263023 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-(5,5-dimethyl-1,2,3,4-tetrahydro-1-benzazepin-8-yl)-2-fluoropyridine-3-carboxamide |
| SMILES | CC1(C)CCCNc2cc(NC(=O)c3cccnc3F)ccc21 |
| InChI | InChI=1S/C18H20FN3O/c1-18(2)8-4-10-20-15-11-12(6-7-14(15)18)22-17(23)13-5-3-9-21-16(13)19/h3,5-7,9,11,20H,4,8,10H2,1-2H3,(H,22,23) |
| InChIKey | XRFXITRBBUAPOR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|