C26H25F5N6O2 — CID 159469291
2-(1H-indazol-6-ylamino)-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-[[(2R)-pyrrolidin-2-yl]methoxy]phenyl]pyridine-3-carboxamide;molecular hydrogen (PubChem CID 159469291) has the molecular formula C26H25F5N6O2 and a molecular weight of 548.52 g/mol. Its IUPAC name is 2-(1H-indazol-6-ylamino)-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-[[(2R)-pyrrolidin-2-yl]methoxy]phenyl]pyridine-3-carboxamide;molecular hydrogen.
| Compound Name | 2-(1H-indazol-6-ylamino)-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-[[(2R)-pyrrolidin-2-yl]methoxy]phenyl]pyridine-3-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 159469291 |
| Molecular Formula | C26H25F5N6O2 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 2-(1H-indazol-6-ylamino)-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-[[(2R)-pyrrolidin-2-yl]methoxy]phenyl]pyridine-3-carboxamide;molecular hydrogen |
| SMILES | O=C(Nc1ccc(C(F)(F)C(F)(F)F)c(OC[C@H]2CCCN2)c1)c1cccnc1Nc1ccc2cn[nH]c2c1.[H][H] |
| InChI | InChI=1S/C26H23F5N6O2.H2/c27-25(28,26(29,30)31)20-8-7-17(12-22(20)39-14-18-3-1-9-32-18)36-24(38)19-4-2-10-33-23(19)35-16-6-5-15-13-34-37-21(15)11-16;/h2,4-8,10-13,18,32H,1,3,9,14H2,(H,33,35)(H,34,37)(H,36,38);1H/t18-;/m1./s1 |
| InChIKey | LVPCUROOYFYLMV-GMUIIQOCSA-N |
| XLogP | 5.98 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|