C25H19N5O — CID 10272638
2-(1H-indazol-6-ylamino)-N-(4-phenylphenyl)pyridine-3-carboxamide (PubChem CID 10272638) has the molecular formula C25H19N5O and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-(1H-indazol-6-ylamino)-N-(4-phenylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-(1H-indazol-6-ylamino)-N-(4-phenylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10272638 |
| Molecular Formula | C25H19N5O |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-(1H-indazol-6-ylamino)-N-(4-phenylphenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)c1cccnc1Nc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C25H19N5O/c31-25(29-20-11-8-18(9-12-20)17-5-2-1-3-6-17)22-7-4-14-26-24(22)28-21-13-10-19-16-27-30-23(19)15-21/h1-16H,(H,26,28)(H,27,30)(H,29,31) |
| InChIKey | RHDIVPANJFAMJB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |