C27H25F6N5O4 — CID 10304079
N-[4-[1,1,1,3,3,3-hexafluoro-2-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]phenyl]-2-(1H-indazol-6-ylamino)pyridine-3-carboxamide (PubChem CID 10304079) has the molecular formula C27H25F6N5O4 and a molecular weight of 597.52 g/mol. Its IUPAC name is N-[4-[1,1,1,3,3,3-hexafluoro-2-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]phenyl]-2-(1H-indazol-6-ylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-[1,1,1,3,3,3-hexafluoro-2-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]phenyl]-2-(1H-indazol-6-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10304079 |
| Molecular Formula | C27H25F6N5O4 |
| Molecular Weight | 597.52 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | N-[4-[1,1,1,3,3,3-hexafluoro-2-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]phenyl]-2-(1H-indazol-6-ylamino)pyridine-3-carboxamide |
| SMILES | COCCOCCOC(c1ccc(NC(=O)c2cccnc2Nc2ccc3cn[nH]c3c2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H25F6N5O4/c1-40-11-12-41-13-14-42-25(26(28,29)30,27(31,32)33)18-5-8-19(9-6-18)37-24(39)21-3-2-10-34-23(21)36-20-7-4-17-16-35-38-22(17)15-20/h2-10,15-16H,11-14H2,1H3,(H,34,36)(H,35,38)(H,37,39) |
| InChIKey | BIIJZBFZFJGYRK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|