C19H19ClF3N3O2 — CID 87108890
2-chloro-N-[3-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 87108890) has the molecular formula C19H19ClF3N3O2 and a molecular weight of 413.83 g/mol. Its IUPAC name is 2-chloro-N-[3-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[3-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87108890 |
| Molecular Formula | C19H19ClF3N3O2 |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-chloro-N-[3-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | CN1CCC[C@@H]1COc1cc(NC(=O)c2cccnc2Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19ClF3N3O2/c1-26-7-3-4-14(26)11-28-15-9-12(19(21,22)23)8-13(10-15)25-18(27)16-5-2-6-24-17(16)20/h2,5-6,8-10,14H,3-4,7,11H2,1H3,(H,25,27)/t14-/m1/s1 |
| InChIKey | RFMKGGUQJQBVIM-CQSZACIVSA-N |
| XLogP | 4.48 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|