C14H9ClF3N3O2 — CID 162621094
2-chloro-N-[[3-(trifluoromethyl)phenyl]carbamoyl]pyridine-3-carboxamide (PubChem CID 162621094) has the molecular formula C14H9ClF3N3O2 and a molecular weight of 343.69 g/mol. Its IUPAC name is 2-chloro-N-[[3-(trifluoromethyl)phenyl]carbamoyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[3-(trifluoromethyl)phenyl]carbamoyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162621094 |
| Molecular Formula | C14H9ClF3N3O2 |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-chloro-N-[[3-(trifluoromethyl)phenyl]carbamoyl]pyridine-3-carboxamide |
| SMILES | O=C(NC(=O)c1cccnc1Cl)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9ClF3N3O2/c15-11-10(5-2-6-19-11)12(22)21-13(23)20-9-4-1-3-8(7-9)14(16,17)18/h1-7H,(H2,20,21,22,23) |
| InChIKey | UCTOHSNEOXXWFY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|