C15H12ClF3N2O — CID 78778446
2-chloro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]pyridine-3-carboxamide (PubChem CID 78778446) has the molecular formula C15H12ClF3N2O and a molecular weight of 328.72 g/mol. Its IUPAC name is 2-chloro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78778446 |
| Molecular Formula | C15H12ClF3N2O |
| Molecular Weight | 328.72 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-chloro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]pyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cccnc1Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12ClF3N2O/c1-9(10-4-2-5-11(8-10)15(17,18)19)21-14(22)12-6-3-7-20-13(12)16/h2-9H,1H3,(H,21,22) |
| InChIKey | JKPQIEUNMNFNSB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|