C16H12ClF4NO — CID 25444134
5-chloro-2-fluoro-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 25444134) has the molecular formula C16H12ClF4NO and a molecular weight of 345.72 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 5-chloro-2-fluoro-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 25444134 |
| Molecular Formula | C16H12ClF4NO |
| Molecular Weight | 345.72 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 5-chloro-2-fluoro-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1cc(Cl)ccc1F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12ClF4NO/c1-9(10-3-2-4-11(7-10)16(19,20)21)22-15(23)13-8-12(17)5-6-14(13)18/h2-9H,1H3,(H,22,23)/t9-/m1/s1 |
| InChIKey | XOSKWJMVRSKZCR-SECBINFHSA-N |
| XLogP | 4.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.72 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |