C15H17F5N2O3 — CID 22249451
1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine (PubChem CID 22249451) has the molecular formula C15H17F5N2O3 and a molecular weight of 368.30 g/mol. Its IUPAC name is 1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine.
| Compound Name | 1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 22249451 |
| Molecular Formula | C15H17F5N2O3 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine |
| SMILES | CN1CCC(COc2cc([N+](=O)[O-])ccc2C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H17F5N2O3/c1-21-6-4-10(5-7-21)9-25-13-8-11(22(23)24)2-3-12(13)14(16,17)15(18,19)20/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | XFPHAFHXDFIFTG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|