C15H24N4O2 — CID 62184650
N-ethyl-2-[(4-methyl-1,4-diazepan-1-yl)methyl]-4-nitroaniline (PubChem CID 62184650) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-ethyl-2-[(4-methyl-1,4-diazepan-1-yl)methyl]-4-nitroaniline.
| Compound Name | N-ethyl-2-[(4-methyl-1,4-diazepan-1-yl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 62184650 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N-ethyl-2-[(4-methyl-1,4-diazepan-1-yl)methyl]-4-nitroaniline |
| SMILES | CCNc1ccc([N+](=O)[O-])cc1CN1CCCN(C)CC1 |
| InChI | InChI=1S/C15H24N4O2/c1-3-16-15-6-5-14(19(20)21)11-13(15)12-18-8-4-7-17(2)9-10-18/h5-6,11,16H,3-4,7-10,12H2,1-2H3 |
| InChIKey | DJFIPMSBDXEGPF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|