C18H29N5O3 — CID 13401339
2,6-bis[(4-methylpiperazin-1-yl)methyl]-4-nitrophenol (PubChem CID 13401339) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2,6-bis[(4-methylpiperazin-1-yl)methyl]-4-nitrophenol.
| Compound Name | 2,6-bis[(4-methylpiperazin-1-yl)methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 13401339 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2,6-bis[(4-methylpiperazin-1-yl)methyl]-4-nitrophenol |
| SMILES | CN1CCN(Cc2cc([N+](=O)[O-])cc(CN3CCN(C)CC3)c2O)CC1 |
| InChI | InChI=1S/C18H29N5O3/c1-19-3-7-21(8-4-19)13-15-11-17(23(25)26)12-16(18(15)24)14-22-9-5-20(2)6-10-22/h11-12,24H,3-10,13-14H2,1-2H3 |
| InChIKey | LCARYNFINKHQOB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 76.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|