C15H19N3O5 — CID 9276123
1-[4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazin-1-yl]ethanone (PubChem CID 9276123) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is 1-[4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 9276123 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-[4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2cc([N+](=O)[O-])cc3c2OCOC3)CC1 |
| InChI | InChI=1S/C15H19N3O5/c1-11(19)17-4-2-16(3-5-17)8-12-6-14(18(20)21)7-13-9-22-10-23-15(12)13/h6-7H,2-5,8-10H2,1H3 |
| InChIKey | RNWDLYJPOBQTMO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|