C20H23N3O5 — CID 17494381
1-(4-methoxyphenyl)-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine (PubChem CID 17494381) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine.
| Compound Name | 1-(4-methoxyphenyl)-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine |
|---|---|
| PubChem CID | 17494381 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine |
| SMILES | COc1ccc(N2CCN(Cc3cc([N+](=O)[O-])cc4c3OCOC4)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-26-19-4-2-17(3-5-19)22-8-6-21(7-9-22)12-15-10-18(23(24)25)11-16-13-27-14-28-20(15)16/h2-5,10-11H,6-9,12-14H2,1H3 |
| InChIKey | SICVGGPWQYPJAA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|