C14H19N3O6S — CID 27128463
1-methylsulfonyl-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine (PubChem CID 27128463) has the molecular formula C14H19N3O6S and a molecular weight of 357.39 g/mol. Its IUPAC name is 1-methylsulfonyl-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine.
| Compound Name | 1-methylsulfonyl-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine |
|---|---|
| PubChem CID | 27128463 |
| Molecular Formula | C14H19N3O6S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-methylsulfonyl-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine |
| SMILES | CS(=O)(=O)N1CCN(Cc2cc([N+](=O)[O-])cc3c2OCOC3)CC1 |
| InChI | InChI=1S/C14H19N3O6S/c1-24(20,21)16-4-2-15(3-5-16)8-11-6-13(17(18)19)7-12-9-22-10-23-14(11)12/h6-7H,2-5,8-10H2,1H3 |
| InChIKey | LMRFADNJCAOBCR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|