C14H18N2O5 — CID 51565621
(3S)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-3-ol (PubChem CID 51565621) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is (3S)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-3-ol.
| Compound Name | (3S)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 51565621 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (3S)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-3-ol |
| SMILES | O=[N+]([O-])c1cc2c(c(CN3CCC[C@H](O)C3)c1)OCOC2 |
| InChI | InChI=1S/C14H18N2O5/c17-13-2-1-3-15(7-13)6-10-4-12(16(18)19)5-11-8-20-9-21-14(10)11/h4-5,13,17H,1-3,6-9H2/t13-/m0/s1 |
| InChIKey | HGYZNBYSTHVBDB-ZDUSSCGKSA-N |
| XLogP | 1.42 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|