C17H22N2O6 — CID 51564633
ethyl (3R)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidine-3-carboxylate (PubChem CID 51564633) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is ethyl (3R)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 51564633 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | ethyl (3R)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(Cc2cc([N+](=O)[O-])cc3c2OCOC3)C1 |
| InChI | InChI=1S/C17H22N2O6/c1-2-24-17(20)12-4-3-5-18(8-12)9-13-6-15(19(21)22)7-14-10-23-11-25-16(13)14/h6-7,12H,2-5,8-11H2,1H3/t12-/m1/s1 |
| InChIKey | BFRCNYOZGYSICN-GFCCVEGCSA-N |
| XLogP | 2.24 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|