C15H19ClN2O4 — CID 2838050
ethyl 1-[(2-chloro-5-nitrophenyl)methyl]piperidine-3-carboxylate (PubChem CID 2838050) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is ethyl 1-[(2-chloro-5-nitrophenyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(2-chloro-5-nitrophenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 2838050 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | ethyl 1-[(2-chloro-5-nitrophenyl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2cc([N+](=O)[O-])ccc2Cl)C1 |
| InChI | InChI=1S/C15H19ClN2O4/c1-2-22-15(19)11-4-3-7-17(9-11)10-12-8-13(18(20)21)5-6-14(12)16/h5-6,8,11H,2-4,7,9-10H2,1H3 |
| InChIKey | LNXZYAGQBUONSI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|