C14H18Cl2N2O2 — CID 104889125
ethyl (3R)-1-[(4,6-dichloro-3-pyridinyl)methyl]piperidine-3-carboxylate (PubChem CID 104889125) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is ethyl (3R)-1-[(4,6-dichloro-3-pyridinyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(4,6-dichloro-3-pyridinyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 104889125 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | ethyl (3R)-1-[(4,6-dichloro-3-pyridinyl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(Cc2cnc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-2-20-14(19)10-4-3-5-18(8-10)9-11-7-17-13(16)6-12(11)15/h6-7,10H,2-5,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | WBZJENLMNMIHAT-SNVBAGLBSA-N |
| XLogP | 3.16 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|