C16H22FNO2 — CID 103885835
ethyl (3R)-1-[(4-fluoro-2-methylphenyl)methyl]piperidine-3-carboxylate (PubChem CID 103885835) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is ethyl (3R)-1-[(4-fluoro-2-methylphenyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(4-fluoro-2-methylphenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 103885835 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | ethyl (3R)-1-[(4-fluoro-2-methylphenyl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(Cc2ccc(F)cc2C)C1 |
| InChI | InChI=1S/C16H22FNO2/c1-3-20-16(19)14-5-4-8-18(11-14)10-13-6-7-15(17)9-12(13)2/h6-7,9,14H,3-5,8,10-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | JULLDBZIMIBZBG-CQSZACIVSA-N |
| XLogP | 2.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |