C24H25F4NO3 — CID 10767316
ethyl (3R)-1-[2-[2,2-bis(2,5-difluorophenyl)ethenoxy]ethyl]piperidine-3-carboxylate (PubChem CID 10767316) has the molecular formula C24H25F4NO3 and a molecular weight of 451.46 g/mol. Its IUPAC name is ethyl (3R)-1-[2-[2,2-bis(2,5-difluorophenyl)ethenoxy]ethyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-[2,2-bis(2,5-difluorophenyl)ethenoxy]ethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 10767316 |
| Molecular Formula | C24H25F4NO3 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | ethyl (3R)-1-[2-[2,2-bis(2,5-difluorophenyl)ethenoxy]ethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(CCOC=C(c2cc(F)ccc2F)c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C24H25F4NO3/c1-2-32-24(30)16-4-3-9-29(14-16)10-11-31-15-21(19-12-17(25)5-7-22(19)27)20-13-18(26)6-8-23(20)28/h5-8,12-13,15-16H,2-4,9-11,14H2,1H3/t16-/m1/s1 |
| InChIKey | OMLDRAUJFVGMGY-MRXNPFEDSA-N |
| XLogP | 4.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|