C29H35F2NO9 — CID 70230542
2,3-dihydroxybutanedioic acid;ethyl (3R)-1-[3-[2,2-bis(4-fluorophenyl)ethenoxy]propyl]piperidine-3-carboxylate (PubChem CID 70230542) has the molecular formula C29H35F2NO9 and a molecular weight of 579.59 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;ethyl (3R)-1-[3-[2,2-bis(4-fluorophenyl)ethenoxy]propyl]piperidine-3-carboxylate.
| Compound Name | 2,3-dihydroxybutanedioic acid;ethyl (3R)-1-[3-[2,2-bis(4-fluorophenyl)ethenoxy]propyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 70230542 |
| Molecular Formula | C29H35F2NO9 |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;ethyl (3R)-1-[3-[2,2-bis(4-fluorophenyl)ethenoxy]propyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(CCCOC=C(c2ccc(F)cc2)c2ccc(F)cc2)C1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C25H29F2NO3.C4H6O6/c1-2-31-25(29)21-5-3-14-28(17-21)15-4-16-30-18-24(19-6-10-22(26)11-7-19)20-8-12-23(27)13-9-20;5-1(3(7)8)2(6)4(9)10/h6-13,18,21H,2-5,14-17H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t21-;/m1./s1 |
| InChIKey | ILJHBZBDVVJWQO-ZMBIFBSDSA-N |
| XLogP | 2.91 |
| TPSA | 153.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|