C22H25NO3 — CID 10620277
(3R)-1-[2-(2,2-diphenylethenoxy)ethyl]piperidine-3-carboxylic acid (PubChem CID 10620277) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (3R)-1-[2-(2,2-diphenylethenoxy)ethyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-(2,2-diphenylethenoxy)ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 10620277 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (3R)-1-[2-(2,2-diphenylethenoxy)ethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(CCOC=C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H25NO3/c24-22(25)20-12-7-13-23(16-20)14-15-26-17-21(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,17,20H,7,12-16H2,(H,24,25)/t20-/m1/s1 |
| InChIKey | QXZRDASZZSRLBB-HXUWFJFHSA-N |
| XLogP | 3.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|