C22H24FNO2 — CID 53323981
(3R)-1-[(Z)-4-(2-fluorophenyl)-4-phenylbut-3-enyl]piperidine-3-carboxylic acid (PubChem CID 53323981) has the molecular formula C22H24FNO2 and a molecular weight of 353.44 g/mol. Its IUPAC name is (3R)-1-[(Z)-4-(2-fluorophenyl)-4-phenylbut-3-enyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(Z)-4-(2-fluorophenyl)-4-phenylbut-3-enyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 53323981 |
| Molecular Formula | C22H24FNO2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (3R)-1-[(Z)-4-(2-fluorophenyl)-4-phenylbut-3-enyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(CC/C=C(/c2ccccc2)c2ccccc2F)C1 |
| InChI | InChI=1S/C22H24FNO2/c23-21-13-5-4-11-20(21)19(17-8-2-1-3-9-17)12-7-15-24-14-6-10-18(16-24)22(25)26/h1-5,8-9,11-13,18H,6-7,10,14-16H2,(H,25,26)/b19-12-/t18-/m1/s1 |
| InChIKey | YJBWTVCFPQFCJM-GEBKJHSDSA-N |
| XLogP | 4.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |