C22H28N2O2 — CID 54441255
(3R)-1-[4-(1-ethylpyrrol-2-yl)-4-phenylbut-3-enyl]piperidine-3-carboxylic acid (PubChem CID 54441255) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (3R)-1-[4-(1-ethylpyrrol-2-yl)-4-phenylbut-3-enyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[4-(1-ethylpyrrol-2-yl)-4-phenylbut-3-enyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54441255 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (3R)-1-[4-(1-ethylpyrrol-2-yl)-4-phenylbut-3-enyl]piperidine-3-carboxylic acid |
| SMILES | CCn1cccc1C(=CCCN1CCC[C@@H](C(=O)O)C1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O2/c1-2-24-16-8-13-21(24)20(18-9-4-3-5-10-18)12-7-15-23-14-6-11-19(17-23)22(25)26/h3-5,8-10,12-13,16,19H,2,6-7,11,14-15,17H2,1H3,(H,25,26)/t19-/m1/s1 |
| InChIKey | WOGDAAPNOVKWJT-LJQANCHMSA-N |
| XLogP | 4.13 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|