C22H30N2O2S — CID 54043289
1-[4-(1-ethylpyrrol-2-yl)-4-(3-ethylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid (PubChem CID 54043289) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-[4-(1-ethylpyrrol-2-yl)-4-(3-ethylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[4-(1-ethylpyrrol-2-yl)-4-(3-ethylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54043289 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[4-(1-ethylpyrrol-2-yl)-4-(3-ethylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid |
| SMILES | CCc1ccsc1C(=CCCN1CCCC(C(=O)O)C1)c1cccn1CC |
| InChI | InChI=1S/C22H30N2O2S/c1-3-17-11-15-27-21(17)19(20-10-7-14-24(20)4-2)9-6-13-23-12-5-8-18(16-23)22(25)26/h7,9-11,14-15,18H,3-6,8,12-13,16H2,1-2H3,(H,25,26) |
| InChIKey | LNVKAXLLUYUWDH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|