C21H28N2O3S2 — CID 10671519
(3R)-1-[2-[bis(3-ethylthiophen-2-yl)methylideneamino]oxyethyl]piperidine-3-carboxylic acid (PubChem CID 10671519) has the molecular formula C21H28N2O3S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is (3R)-1-[2-[bis(3-ethylthiophen-2-yl)methylideneamino]oxyethyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-[bis(3-ethylthiophen-2-yl)methylideneamino]oxyethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 10671519 |
| Molecular Formula | C21H28N2O3S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (3R)-1-[2-[bis(3-ethylthiophen-2-yl)methylideneamino]oxyethyl]piperidine-3-carboxylic acid |
| SMILES | CCc1ccsc1C(=NOCCN1CCC[C@@H](C(=O)O)C1)c1sccc1CC |
| InChI | InChI=1S/C21H28N2O3S2/c1-3-15-7-12-27-19(15)18(20-16(4-2)8-13-28-20)22-26-11-10-23-9-5-6-17(14-23)21(24)25/h7-8,12-13,17H,3-6,9-11,14H2,1-2H3,(H,24,25)/t17-/m1/s1 |
| InChIKey | ZCHANJJDHGASNE-QGZVFWFLSA-N |
| XLogP | 4.50 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|