C20H23Cl3N2O3S — CID 75105340
1-[2-[[(2,4-dichlorophenyl)-(3-methylthiophen-2-yl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride (PubChem CID 75105340) has the molecular formula C20H23Cl3N2O3S and a molecular weight of 477.84 g/mol. Its IUPAC name is 1-[2-[[(2,4-dichlorophenyl)-(3-methylthiophen-2-yl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-[[(2,4-dichlorophenyl)-(3-methylthiophen-2-yl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 75105340 |
| Molecular Formula | C20H23Cl3N2O3S |
| Molecular Weight | 477.84 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 1-[2-[[(2,4-dichlorophenyl)-(3-methylthiophen-2-yl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride |
| SMILES | Cc1ccsc1C(=NOCCN1CCCC(C(=O)O)C1)c1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C20H22Cl2N2O3S.ClH/c1-13-6-10-28-19(13)18(16-5-4-15(21)11-17(16)22)23-27-9-8-24-7-2-3-14(12-24)20(25)26;/h4-6,10-11,14H,2-3,7-9,12H2,1H3,(H,25,26);1H |
| InChIKey | UGCVLOPCYPIWQN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.84 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|