C21H23ClN2O3 — CID 54307891
1-[2-[[(2-chlorophenyl)-phenylmethylidene]amino]oxyethyl]piperidine-3-carboxylic acid (PubChem CID 54307891) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is 1-[2-[[(2-chlorophenyl)-phenylmethylidene]amino]oxyethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[[(2-chlorophenyl)-phenylmethylidene]amino]oxyethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54307891 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[2-[[(2-chlorophenyl)-phenylmethylidene]amino]oxyethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(CCON=C(c2ccccc2)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C21H23ClN2O3/c22-19-11-5-4-10-18(19)20(16-7-2-1-3-8-16)23-27-14-13-24-12-6-9-17(15-24)21(25)26/h1-5,7-8,10-11,17H,6,9,12-15H2,(H,25,26) |
| InChIKey | SIUWHFGLPSVFEL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|