C21H23ClF2N2O3 — CID 173282529
1-[2-[[(2-fluorophenyl)-(4-fluorophenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride (PubChem CID 173282529) has the molecular formula C21H23ClF2N2O3 and a molecular weight of 424.88 g/mol. Its IUPAC name is 1-[2-[[(2-fluorophenyl)-(4-fluorophenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-[[(2-fluorophenyl)-(4-fluorophenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 173282529 |
| Molecular Formula | C21H23ClF2N2O3 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-[2-[[(2-fluorophenyl)-(4-fluorophenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCCN(CCON=C(c2ccc(F)cc2)c2ccccc2F)C1 |
| InChI | InChI=1S/C21H22F2N2O3.ClH/c22-17-9-7-15(8-10-17)20(18-5-1-2-6-19(18)23)24-28-13-12-25-11-3-4-16(14-25)21(26)27;/h1-2,5-10,16H,3-4,11-14H2,(H,26,27);1H |
| InChIKey | HSWWOQVCMXNOFE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|