C23H23F2NO4 — CID 71660328
1-[2-[(E)-2-[5-fluoro-2-(2-fluorobenzoyl)phenyl]ethenoxy]ethyl]piperidine-3-carboxylic acid (PubChem CID 71660328) has the molecular formula C23H23F2NO4 and a molecular weight of 415.44 g/mol. Its IUPAC name is 1-[2-[(E)-2-[5-fluoro-2-(2-fluorobenzoyl)phenyl]ethenoxy]ethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[(E)-2-[5-fluoro-2-(2-fluorobenzoyl)phenyl]ethenoxy]ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 71660328 |
| Molecular Formula | C23H23F2NO4 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-[2-[(E)-2-[5-fluoro-2-(2-fluorobenzoyl)phenyl]ethenoxy]ethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(c1ccccc1F)c1ccc(F)cc1/C=C/OCCN1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C23H23F2NO4/c24-18-7-8-19(22(27)20-5-1-2-6-21(20)25)16(14-18)9-12-30-13-11-26-10-3-4-17(15-26)23(28)29/h1-2,5-9,12,14,17H,3-4,10-11,13,15H2,(H,28,29)/b12-9+ |
| InChIKey | YHZWVKZUCDXZTB-FMIVXFBMSA-N |
| XLogP | 3.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|