C24H30ClNO3 — CID 45261563
(3R)-1-[2-[2,2-bis(2-methylphenyl)ethenoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride (PubChem CID 45261563) has the molecular formula C24H30ClNO3 and a molecular weight of 415.96 g/mol. Its IUPAC name is (3R)-1-[2-[2,2-bis(2-methylphenyl)ethenoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride.
| Compound Name | (3R)-1-[2-[2,2-bis(2-methylphenyl)ethenoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 45261563 |
| Molecular Formula | C24H30ClNO3 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (3R)-1-[2-[2,2-bis(2-methylphenyl)ethenoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride |
| SMILES | Cc1ccccc1C(=COCCN1CCC[C@@H](C(=O)O)C1)c1ccccc1C.Cl |
| InChI | InChI=1S/C24H29NO3.ClH/c1-18-8-3-5-11-21(18)23(22-12-6-4-9-19(22)2)17-28-15-14-25-13-7-10-20(16-25)24(26)27;/h3-6,8-9,11-12,17,20H,7,10,13-16H2,1-2H3,(H,26,27);1H/t20-;/m1./s1 |
| InChIKey | BVNIRAQMZHJLOR-VEIFNGETSA-N |
| XLogP | 4.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|