C21H27N3O2 — CID 54282670
1-[4-(2-methylphenyl)-4-(1-methylpyrazol-3-yl)but-3-enyl]piperidine-3-carboxylic acid (PubChem CID 54282670) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[4-(2-methylphenyl)-4-(1-methylpyrazol-3-yl)but-3-enyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[4-(2-methylphenyl)-4-(1-methylpyrazol-3-yl)but-3-enyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54282670 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-[4-(2-methylphenyl)-4-(1-methylpyrazol-3-yl)but-3-enyl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccccc1C(=CCCN1CCCC(C(=O)O)C1)c1ccn(C)n1 |
| InChI | InChI=1S/C21H27N3O2/c1-16-7-3-4-9-18(16)19(20-11-14-23(2)22-20)10-6-13-24-12-5-8-17(15-24)21(25)26/h3-4,7,9-11,14,17H,5-6,8,12-13,15H2,1-2H3,(H,25,26) |
| InChIKey | RRWRRJXZZSQORW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |