C22H24ClF4NO3 — CID 70228287
1-[2-[2,2-bis(2,5-difluorophenyl)ethoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride (PubChem CID 70228287) has the molecular formula C22H24ClF4NO3 and a molecular weight of 461.88 g/mol. Its IUPAC name is 1-[2-[2,2-bis(2,5-difluorophenyl)ethoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-[2,2-bis(2,5-difluorophenyl)ethoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70228287 |
| Molecular Formula | C22H24ClF4NO3 |
| Molecular Weight | 461.88 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 1-[2-[2,2-bis(2,5-difluorophenyl)ethoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCCN(CCOCC(c2cc(F)ccc2F)c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C22H23F4NO3.ClH/c23-15-3-5-20(25)17(10-15)19(18-11-16(24)4-6-21(18)26)13-30-9-8-27-7-1-2-14(12-27)22(28)29;/h3-6,10-11,14,19H,1-2,7-9,12-13H2,(H,28,29);1H |
| InChIKey | VBVBWJLXYAEZIN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.88 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|