C10H19NO4 — CID 61070324
1-[2-(2-hydroxyethoxy)ethyl]piperidine-3-carboxylic acid (PubChem CID 61070324) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 61070324 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(CCOCCO)C1 |
| InChI | InChI=1S/C10H19NO4/c12-5-7-15-6-4-11-3-1-2-9(8-11)10(13)14/h9,12H,1-8H2,(H,13,14) |
| InChIKey | CTMNJECLTSQWAF-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|