C24H32N2O3 — CID 21266393
1-[2-[4-(N-phenylanilino)butoxy]ethyl]piperidine-3-carboxylic acid (PubChem CID 21266393) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-[2-[4-(N-phenylanilino)butoxy]ethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[4-(N-phenylanilino)butoxy]ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 21266393 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-[2-[4-(N-phenylanilino)butoxy]ethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(CCOCCCCN(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C24H32N2O3/c27-24(28)21-10-9-15-25(20-21)17-19-29-18-8-7-16-26(22-11-3-1-4-12-22)23-13-5-2-6-14-23/h1-6,11-14,21H,7-10,15-20H2,(H,27,28) |
| InChIKey | KZTHOGBXZVZSRD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|