C24H33ClN2O2 — CID 45261987
(3R)-1-[6-(N-phenylanilino)hexyl]piperidine-3-carboxylic acid;hydrochloride (PubChem CID 45261987) has the molecular formula C24H33ClN2O2 and a molecular weight of 416.99 g/mol. Its IUPAC name is (3R)-1-[6-(N-phenylanilino)hexyl]piperidine-3-carboxylic acid;hydrochloride.
| Compound Name | (3R)-1-[6-(N-phenylanilino)hexyl]piperidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 45261987 |
| Molecular Formula | C24H33ClN2O2 |
| Molecular Weight | 416.99 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (3R)-1-[6-(N-phenylanilino)hexyl]piperidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@H]1CCCN(CCCCCCN(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C24H32N2O2.ClH/c27-24(28)21-12-11-18-25(20-21)17-9-1-2-10-19-26(22-13-5-3-6-14-22)23-15-7-4-8-16-23;/h3-8,13-16,21H,1-2,9-12,17-20H2,(H,27,28);1H/t21-;/m1./s1 |
| InChIKey | FUESIYSAMXENEI-ZMBIFBSDSA-N |
| XLogP | 5.60 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.99 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|