C16H24ClNO3 — CID 67723520
(3R)-1-(4-phenoxybutyl)piperidine-3-carboxylic acid;hydrochloride (PubChem CID 67723520) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is (3R)-1-(4-phenoxybutyl)piperidine-3-carboxylic acid;hydrochloride.
| Compound Name | (3R)-1-(4-phenoxybutyl)piperidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67723520 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (3R)-1-(4-phenoxybutyl)piperidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@H]1CCCN(CCCCOc2ccccc2)C1 |
| InChI | InChI=1S/C16H23NO3.ClH/c18-16(19)14-7-6-11-17(13-14)10-4-5-12-20-15-8-2-1-3-9-15;/h1-3,8-9,14H,4-7,10-13H2,(H,18,19);1H/t14-;/m1./s1 |
| InChIKey | RYMPQNFHLUARKH-PFEQFJNWSA-N |
| XLogP | 3.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|