C32H44N2O6 — CID 175890294
1-[3-[3-[3-[3-(3-carboxypiperidin-1-yl)propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]piperidine-3-carboxylic acid (PubChem CID 175890294) has the molecular formula C32H44N2O6 and a molecular weight of 552.71 g/mol. Its IUPAC name is 1-[3-[3-[3-[3-(3-carboxypiperidin-1-yl)propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[3-[3-[3-[3-(3-carboxypiperidin-1-yl)propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 175890294 |
| Molecular Formula | C32H44N2O6 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 1-[3-[3-[3-[3-(3-carboxypiperidin-1-yl)propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]piperidine-3-carboxylic acid |
| SMILES | Cc1c(OCCCN2CCCC(C(=O)O)C2)cccc1-c1cccc(OCCCN2CCCC(C(=O)O)C2)c1C |
| InChI | InChI=1S/C32H44N2O6/c1-23-27(11-3-13-29(23)39-19-7-17-33-15-5-9-25(21-33)31(35)36)28-12-4-14-30(24(28)2)40-20-8-18-34-16-6-10-26(22-34)32(37)38/h3-4,11-14,25-26H,5-10,15-22H2,1-2H3,(H,35,36)(H,37,38) |
| InChIKey | GYYVGEMSSWKNMD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|