C30H44N2O4 — CID 134282554
(3R)-1-[3-[3-[3-[3-[3-(hydroxymethyl)piperidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]pyrrolidin-3-ol (PubChem CID 134282554) has the molecular formula C30H44N2O4 and a molecular weight of 496.69 g/mol. Its IUPAC name is (3R)-1-[3-[3-[3-[3-[3-(hydroxymethyl)piperidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[3-[3-[3-[3-[3-(hydroxymethyl)piperidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 134282554 |
| Molecular Formula | C30H44N2O4 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | (3R)-1-[3-[3-[3-[3-[3-(hydroxymethyl)piperidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]pyrrolidin-3-ol |
| SMILES | Cc1c(OCCCN2CCCC(CO)C2)cccc1-c1cccc(OCCCN2CC[C@@H](O)C2)c1C |
| InChI | InChI=1S/C30H44N2O4/c1-23-27(9-3-11-29(23)35-18-6-15-31-14-5-8-25(20-31)22-33)28-10-4-12-30(24(28)2)36-19-7-16-32-17-13-26(34)21-32/h3-4,9-12,25-26,33-34H,5-8,13-22H2,1-2H3/t25?,26-/m1/s1 |
| InChIKey | BOMXRMMXFIFBFN-FXDYGKIASA-N |
| XLogP | 4.28 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|